C15H14F6O2 — CID 122503805
4-[difluoro-[3-fluoro-4-(trifluoromethyl)phenoxy]methyl]cyclohexane-1-carbaldehyde (PubChem CID 122503805) has the molecular formula C15H14F6O2 and a molecular weight of 340.26 g/mol. Its IUPAC name is 4-[difluoro-[3-fluoro-4-(trifluoromethyl)phenoxy]methyl]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[difluoro-[3-fluoro-4-(trifluoromethyl)phenoxy]methyl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 122503805 |
| Molecular Formula | C15H14F6O2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 4-[difluoro-[3-fluoro-4-(trifluoromethyl)phenoxy]methyl]cyclohexane-1-carbaldehyde |
| SMILES | O=CC1CCC(C(F)(F)Oc2ccc(C(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C15H14F6O2/c16-13-7-11(5-6-12(13)14(17,18)19)23-15(20,21)10-3-1-9(8-22)2-4-10/h5-10H,1-4H2 |
| InChIKey | WOGSQCWRXRMKQE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|