C15H16F4O2 — CID 89144613
4-[(3,5-difluoro-4-methylphenoxy)-difluoromethyl]cyclohexane-1-carbaldehyde (PubChem CID 89144613) has the molecular formula C15H16F4O2 and a molecular weight of 304.28 g/mol. Its IUPAC name is 4-[(3,5-difluoro-4-methylphenoxy)-difluoromethyl]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[(3,5-difluoro-4-methylphenoxy)-difluoromethyl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 89144613 |
| Molecular Formula | C15H16F4O2 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-[(3,5-difluoro-4-methylphenoxy)-difluoromethyl]cyclohexane-1-carbaldehyde |
| SMILES | Cc1c(F)cc(OC(F)(F)C2CCC(C=O)CC2)cc1F |
| InChI | InChI=1S/C15H16F4O2/c1-9-13(16)6-12(7-14(9)17)21-15(18,19)11-4-2-10(8-20)3-5-11/h6-8,10-11H,2-5H2,1H3 |
| InChIKey | OKHVBHVZIDAAMC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|