C14H15F4IO — CID 121367346
5-[difluoro-(4-methylcyclohexyl)methoxy]-1,3-difluoro-2-iodobenzene (PubChem CID 121367346) has the molecular formula C14H15F4IO and a molecular weight of 402.17 g/mol. Its IUPAC name is 5-[difluoro-(4-methylcyclohexyl)methoxy]-1,3-difluoro-2-iodobenzene.
| Compound Name | 5-[difluoro-(4-methylcyclohexyl)methoxy]-1,3-difluoro-2-iodobenzene |
|---|---|
| PubChem CID | 121367346 |
| Molecular Formula | C14H15F4IO |
| Molecular Weight | 402.17 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 5-[difluoro-(4-methylcyclohexyl)methoxy]-1,3-difluoro-2-iodobenzene |
| SMILES | CC1CCC(C(F)(F)Oc2cc(F)c(I)c(F)c2)CC1 |
| InChI | InChI=1S/C14H15F4IO/c1-8-2-4-9(5-3-8)14(17,18)20-10-6-11(15)13(19)12(16)7-10/h6-9H,2-5H2,1H3 |
| InChIKey | FXFNVRHUBLJFLA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.17 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|