C27H31F7O3 — CID 159172924
molecular hydrogen;(3,4,5-trifluorophenyl) 4-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,6-difluorobenzoate (PubChem CID 159172924) has the molecular formula C27H31F7O3 and a molecular weight of 536.53 g/mol. Its IUPAC name is molecular hydrogen;(3,4,5-trifluorophenyl) 4-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,6-difluorobenzoate.
| Compound Name | molecular hydrogen;(3,4,5-trifluorophenyl) 4-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 159172924 |
| Molecular Formula | C27H31F7O3 |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | molecular hydrogen;(3,4,5-trifluorophenyl) 4-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-2,6-difluorobenzoate |
| SMILES | CC1CCC(C2CCC(C(F)(F)Oc3cc(F)c(C(=O)Oc4cc(F)c(F)c(F)c4)c(F)c3)CC2)CC1.[H][H].[H][H] |
| InChI | InChI=1S/C27H27F7O3.2H2/c1-14-2-4-15(5-3-14)16-6-8-17(9-7-16)27(33,34)37-19-12-20(28)24(21(29)13-19)26(35)36-18-10-22(30)25(32)23(31)11-18;;/h10-17H,2-9H2,1H3;2*1H |
| InChIKey | KLXMFPOZZWKNAS-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|