C21H29F5O3 — CID 142146438
4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]cyclohexane-1,1-diol;ethane (PubChem CID 142146438) has the molecular formula C21H29F5O3 and a molecular weight of 424.45 g/mol. Its IUPAC name is 4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]cyclohexane-1,1-diol;ethane.
| Compound Name | 4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]cyclohexane-1,1-diol;ethane |
|---|---|
| PubChem CID | 142146438 |
| Molecular Formula | C21H29F5O3 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]cyclohexane-1,1-diol;ethane |
| SMILES | CC.OC1(O)CCC(C2CCC(C(F)(F)Oc3cc(F)c(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C19H23F5O3.C2H6/c20-15-9-14(10-16(21)17(15)22)27-19(23,24)13-3-1-11(2-4-13)12-5-7-18(25,26)8-6-12;1-2/h9-13,25-26H,1-8H2;1-2H3 |
| InChIKey | NWSDOHZTYDTLHD-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|