C13H13F5O — CID 126565052
5-[cyclohexyl(difluoro)methoxy]-1,2,3-trifluorobenzene (PubChem CID 126565052) has the molecular formula C13H13F5O and a molecular weight of 280.24 g/mol. Its IUPAC name is 5-[cyclohexyl(difluoro)methoxy]-1,2,3-trifluorobenzene.
| Compound Name | 5-[cyclohexyl(difluoro)methoxy]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 126565052 |
| Molecular Formula | C13H13F5O |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 5-[cyclohexyl(difluoro)methoxy]-1,2,3-trifluorobenzene |
| SMILES | Fc1cc(OC(F)(F)C2CCCCC2)cc(F)c1F |
| InChI | InChI=1S/C13H13F5O/c14-10-6-9(7-11(15)12(10)16)19-13(17,18)8-4-2-1-3-5-8/h6-8H,1-5H2 |
| InChIKey | HYTWAXRMLLXXPF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|