C32H41F5O — CID 143908561
(1R)-1-[4-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]cyclohexyl]cyclohexyl]bicyclo[2.2.1]hept-2-ene (PubChem CID 143908561) has the molecular formula C32H41F5O and a molecular weight of 536.67 g/mol. Its IUPAC name is (1R)-1-[4-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]cyclohexyl]cyclohexyl]bicyclo[2.2.1]hept-2-ene.
| Compound Name | (1R)-1-[4-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]cyclohexyl]cyclohexyl]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 143908561 |
| Molecular Formula | C32H41F5O |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | (1R)-1-[4-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]cyclohexyl]cyclohexyl]bicyclo[2.2.1]hept-2-ene |
| SMILES | Fc1cc(OC(F)(F)C2CCC(C3CCC(C4CCC([C@@]56C=CC(CC5)C6)CC4)CC3)CC2)cc(F)c1F |
| InChI | InChI=1S/C32H41F5O/c33-28-17-27(18-29(34)30(28)35)38-32(36,37)26-11-7-24(8-12-26)22-3-1-21(2-4-22)23-5-9-25(10-6-23)31-15-13-20(19-31)14-16-31/h13,15,17-18,20-26H,1-12,14,16,19H2/t20?,21?,22?,23?,24?,25?,26?,31-/m0/s1 |
| InChIKey | PBQVSTHARQQEQW-GAOMWKBPSA-N |
| XLogP | 9.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|