C15H20F2O — CID 20705614
1-[difluoro-(4-methylcyclohexyl)methoxy]-4-methylbenzene (PubChem CID 20705614) has the molecular formula C15H20F2O and a molecular weight of 254.32 g/mol. Its IUPAC name is 1-[difluoro-(4-methylcyclohexyl)methoxy]-4-methylbenzene.
| Compound Name | 1-[difluoro-(4-methylcyclohexyl)methoxy]-4-methylbenzene |
|---|---|
| PubChem CID | 20705614 |
| Molecular Formula | C15H20F2O |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-[difluoro-(4-methylcyclohexyl)methoxy]-4-methylbenzene |
| SMILES | Cc1ccc(OC(F)(F)C2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C15H20F2O/c1-11-3-7-13(8-4-11)15(16,17)18-14-9-5-12(2)6-10-14/h5-6,9-11,13H,3-4,7-8H2,1-2H3 |
| InChIKey | RXRGJEDQSMSGHZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |