C21H29F3O2 — CID 20596725
1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-4-(fluoromethoxy)benzene (PubChem CID 20596725) has the molecular formula C21H29F3O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-4-(fluoromethoxy)benzene.
| Compound Name | 1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-4-(fluoromethoxy)benzene |
|---|---|
| PubChem CID | 20596725 |
| Molecular Formula | C21H29F3O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-4-(fluoromethoxy)benzene |
| SMILES | CC1CCC(C2CCC(C(F)(F)Oc3ccc(OCF)cc3)CC2)CC1 |
| InChI | InChI=1S/C21H29F3O2/c1-15-2-4-16(5-3-15)17-6-8-18(9-7-17)21(23,24)26-20-12-10-19(11-13-20)25-14-22/h10-13,15-18H,2-9,14H2,1H3 |
| InChIKey | ZDSWZQHWLLVOQM-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |