C25H34F2O2 — CID 59695826
1-[4-[difluoro-[4-(4-propylcyclohexyl)cyclohexyl]methoxy]phenyl]prop-2-en-1-one (PubChem CID 59695826) has the molecular formula C25H34F2O2 and a molecular weight of 404.54 g/mol. Its IUPAC name is 1-[4-[difluoro-[4-(4-propylcyclohexyl)cyclohexyl]methoxy]phenyl]prop-2-en-1-one.
| Compound Name | 1-[4-[difluoro-[4-(4-propylcyclohexyl)cyclohexyl]methoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 59695826 |
| Molecular Formula | C25H34F2O2 |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 1-[4-[difluoro-[4-(4-propylcyclohexyl)cyclohexyl]methoxy]phenyl]prop-2-en-1-one |
| SMILES | C=CC(=O)c1ccc(OC(F)(F)C2CCC(C3CCC(CCC)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H34F2O2/c1-3-5-18-6-8-19(9-7-18)20-10-14-22(15-11-20)25(26,27)29-23-16-12-21(13-17-23)24(28)4-2/h4,12-13,16-20,22H,2-3,5-11,14-15H2,1H3 |
| InChIKey | FQRXMLMBHJLADG-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|