C21H28F2O3 — CID 67454974
3-[4-[difluoro-(4-pentylcyclohexyl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 67454974) has the molecular formula C21H28F2O3 and a molecular weight of 366.45 g/mol. Its IUPAC name is 3-[4-[difluoro-(4-pentylcyclohexyl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[difluoro-(4-pentylcyclohexyl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67454974 |
| Molecular Formula | C21H28F2O3 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 3-[4-[difluoro-(4-pentylcyclohexyl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | CCCCCC1CCC(C(F)(F)Oc2ccc(C=CC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C21H28F2O3/c1-2-3-4-5-16-6-11-18(12-7-16)21(22,23)26-19-13-8-17(9-14-19)10-15-20(24)25/h8-10,13-16,18H,2-7,11-12H2,1H3,(H,24,25) |
| InChIKey | SGAKISAHWUAFLF-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|