C19H21F5O3 — CID 123560850
3-[4-[difluoro-[4-(3,3,3-trifluoropropyl)cyclohexyl]methoxy]phenyl]prop-2-enoic acid (PubChem CID 123560850) has the molecular formula C19H21F5O3 and a molecular weight of 392.36 g/mol. Its IUPAC name is 3-[4-[difluoro-[4-(3,3,3-trifluoropropyl)cyclohexyl]methoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[difluoro-[4-(3,3,3-trifluoropropyl)cyclohexyl]methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123560850 |
| Molecular Formula | C19H21F5O3 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 3-[4-[difluoro-[4-(3,3,3-trifluoropropyl)cyclohexyl]methoxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(OC(F)(F)C2CCC(CCC(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C19H21F5O3/c20-18(21,22)12-11-14-1-6-15(7-2-14)19(23,24)27-16-8-3-13(4-9-16)5-10-17(25)26/h3-5,8-10,14-15H,1-2,6-7,11-12H2,(H,25,26) |
| InChIKey | DAEYFNGPHDVKHD-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|