C11H7F5O3 — CID 169461062
3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]prop-2-enoic acid (PubChem CID 169461062) has the molecular formula C11H7F5O3 and a molecular weight of 282.16 g/mol. Its IUPAC name is 3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 169461062 |
| Molecular Formula | C11H7F5O3 |
| Molecular Weight | 282.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(OC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H7F5O3/c12-10(13,14)11(15,16)19-8-4-1-7(2-5-8)3-6-9(17)18/h1-6H,(H,17,18) |
| InChIKey | QUGNNYGTYKNWEC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.16 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|