C17H24O3 — CID 144989112
(E)-3-[4-(2,4,4-trimethylpentan-2-yloxy)phenyl]prop-2-enoic acid (PubChem CID 144989112) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (E)-3-[4-(2,4,4-trimethylpentan-2-yloxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(2,4,4-trimethylpentan-2-yloxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 144989112 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (E)-3-[4-(2,4,4-trimethylpentan-2-yloxy)phenyl]prop-2-enoic acid |
| SMILES | CC(C)(C)CC(C)(C)Oc1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C17H24O3/c1-16(2,3)12-17(4,5)20-14-9-6-13(7-10-14)8-11-15(18)19/h6-11H,12H2,1-5H3,(H,18,19)/b11-8+ |
| InChIKey | CYFZNTPSAQLGJI-DHZHZOJOSA-N |
| XLogP | 4.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|