C14H25O5P — CID 156565005
phosphoric acid;2,4,4-trimethylpentan-2-yloxybenzene (PubChem CID 156565005) has the molecular formula C14H25O5P and a molecular weight of 304.32 g/mol. Its IUPAC name is phosphoric acid;2,4,4-trimethylpentan-2-yloxybenzene.
| Compound Name | phosphoric acid;2,4,4-trimethylpentan-2-yloxybenzene |
|---|---|
| PubChem CID | 156565005 |
| Molecular Formula | C14H25O5P |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | phosphoric acid;2,4,4-trimethylpentan-2-yloxybenzene |
| SMILES | CC(C)(C)CC(C)(C)Oc1ccccc1.O=P(O)(O)O |
| InChI | InChI=1S/C14H22O.H3O4P/c1-13(2,3)11-14(4,5)15-12-9-7-6-8-10-12;1-5(2,3)4/h6-10H,11H2,1-5H3;(H3,1,2,3,4) |
| InChIKey | BQSBVTJPXPXGQZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|