C18H13F5O3 — CID 89400714
(E)-3-[4-[difluoro-[4-(2,2,2-trifluoroethyl)phenyl]methoxy]phenyl]prop-2-enoic acid (PubChem CID 89400714) has the molecular formula C18H13F5O3 and a molecular weight of 372.29 g/mol. Its IUPAC name is (E)-3-[4-[difluoro-[4-(2,2,2-trifluoroethyl)phenyl]methoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[difluoro-[4-(2,2,2-trifluoroethyl)phenyl]methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89400714 |
| Molecular Formula | C18H13F5O3 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (E)-3-[4-[difluoro-[4-(2,2,2-trifluoroethyl)phenyl]methoxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(OC(F)(F)c2ccc(CC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H13F5O3/c19-17(20,21)11-13-1-6-14(7-2-13)18(22,23)26-15-8-3-12(4-9-15)5-10-16(24)25/h1-10H,11H2,(H,24,25)/b10-5+ |
| InChIKey | MWZHIJKPMFSDQY-BJMVGYQFSA-N |
| XLogP | 5.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|