C21H21F3O4 — CID 89401279
(E)-3-[4-[difluoro-[4-(5-fluoropentoxy)phenoxy]methyl]phenyl]prop-2-enoic acid (PubChem CID 89401279) has the molecular formula C21H21F3O4 and a molecular weight of 394.39 g/mol. Its IUPAC name is (E)-3-[4-[difluoro-[4-(5-fluoropentoxy)phenoxy]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[difluoro-[4-(5-fluoropentoxy)phenoxy]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89401279 |
| Molecular Formula | C21H21F3O4 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (E)-3-[4-[difluoro-[4-(5-fluoropentoxy)phenoxy]methyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(C(F)(F)Oc2ccc(OCCCCCF)cc2)cc1 |
| InChI | InChI=1S/C21H21F3O4/c22-14-2-1-3-15-27-18-9-11-19(12-10-18)28-21(23,24)17-7-4-16(5-8-17)6-13-20(25)26/h4-13H,1-3,14-15H2,(H,25,26)/b13-6+ |
| InChIKey | PEOXFVGWGHACAF-AWNIVKPZSA-N |
| XLogP | 5.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|