C22H20F6O4 — CID 89400836
(E)-3-[4-[difluoro-[2-fluoro-4-(6,6,6-trifluorohexoxy)phenoxy]methyl]phenyl]prop-2-enoic acid (PubChem CID 89400836) has the molecular formula C22H20F6O4 and a molecular weight of 462.39 g/mol. Its IUPAC name is (E)-3-[4-[difluoro-[2-fluoro-4-(6,6,6-trifluorohexoxy)phenoxy]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[difluoro-[2-fluoro-4-(6,6,6-trifluorohexoxy)phenoxy]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89400836 |
| Molecular Formula | C22H20F6O4 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | (E)-3-[4-[difluoro-[2-fluoro-4-(6,6,6-trifluorohexoxy)phenoxy]methyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(C(F)(F)Oc2ccc(OCCCCCC(F)(F)F)cc2F)cc1 |
| InChI | InChI=1S/C22H20F6O4/c23-18-14-17(31-13-3-1-2-12-21(24,25)26)9-10-19(18)32-22(27,28)16-7-4-15(5-8-16)6-11-20(29)30/h4-11,14H,1-3,12-13H2,(H,29,30)/b11-6+ |
| InChIKey | BZOIVHMPKKLOOX-IZZDOVSWSA-N |
| XLogP | 6.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|