C20H16F6O4 — CID 172807411
[4-[difluoro-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenoxy]methyl]phenyl] prop-2-enoate (PubChem CID 172807411) has the molecular formula C20H16F6O4 and a molecular weight of 434.33 g/mol. Its IUPAC name is [4-[difluoro-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenoxy]methyl]phenyl] prop-2-enoate.
| Compound Name | [4-[difluoro-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenoxy]methyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 172807411 |
| Molecular Formula | C20H16F6O4 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | [4-[difluoro-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenoxy]methyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C(F)(F)Oc2ccc(OCCCC(F)(F)F)cc2F)cc1 |
| InChI | InChI=1S/C20H16F6O4/c1-2-18(27)29-14-6-4-13(5-7-14)20(25,26)30-17-9-8-15(12-16(17)21)28-11-3-10-19(22,23)24/h2,4-9,12H,1,3,10-11H2 |
| InChIKey | RRXPLURPNPLLIM-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|