C10H9ClF4O — CID 82727729
1-chloro-2-fluoro-4-(4,4,4-trifluorobutoxy)benzene (PubChem CID 82727729) has the molecular formula C10H9ClF4O and a molecular weight of 256.63 g/mol. Its IUPAC name is 1-chloro-2-fluoro-4-(4,4,4-trifluorobutoxy)benzene.
| Compound Name | 1-chloro-2-fluoro-4-(4,4,4-trifluorobutoxy)benzene |
|---|---|
| PubChem CID | 82727729 |
| Molecular Formula | C10H9ClF4O |
| Molecular Weight | 256.63 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 1-chloro-2-fluoro-4-(4,4,4-trifluorobutoxy)benzene |
| SMILES | Fc1cc(OCCCC(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C10H9ClF4O/c11-8-3-2-7(6-9(8)12)16-5-1-4-10(13,14)15/h2-3,6H,1,4-5H2 |
| InChIKey | KBDUUBQQQFSRMO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.63 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|