C9H7ClF4O2 — CID 106706442
1-chloro-2-fluoro-4-(2,2,2-trifluoroethoxymethoxy)benzene (PubChem CID 106706442) has the molecular formula C9H7ClF4O2 and a molecular weight of 258.60 g/mol. Its IUPAC name is 1-chloro-2-fluoro-4-(2,2,2-trifluoroethoxymethoxy)benzene.
| Compound Name | 1-chloro-2-fluoro-4-(2,2,2-trifluoroethoxymethoxy)benzene |
|---|---|
| PubChem CID | 106706442 |
| Molecular Formula | C9H7ClF4O2 |
| Molecular Weight | 258.60 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 1-chloro-2-fluoro-4-(2,2,2-trifluoroethoxymethoxy)benzene |
| SMILES | Fc1cc(OCOCC(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C9H7ClF4O2/c10-7-2-1-6(3-8(7)11)16-5-15-4-9(12,13)14/h1-3H,4-5H2 |
| InChIKey | YQCQIPVKMIBHLG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.60 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|