C9H9ClF3NO2 — CID 106704391
2-chloro-4-(2,2,2-trifluoroethoxymethoxy)aniline (PubChem CID 106704391) has the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. Its IUPAC name is 2-chloro-4-(2,2,2-trifluoroethoxymethoxy)aniline.
| Compound Name | 2-chloro-4-(2,2,2-trifluoroethoxymethoxy)aniline |
|---|---|
| PubChem CID | 106704391 |
| Molecular Formula | C9H9ClF3NO2 |
| Molecular Weight | 255.62 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-chloro-4-(2,2,2-trifluoroethoxymethoxy)aniline |
| SMILES | Nc1ccc(OCOCC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C9H9ClF3NO2/c10-7-3-6(1-2-8(7)14)16-5-15-4-9(11,12)13/h1-3H,4-5,14H2 |
| InChIKey | CJEIKNSNGYMYDK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.62 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|