C9H7ClF3NO4 — CID 106706680
2-chloro-1-nitro-4-(2,2,2-trifluoroethoxymethoxy)benzene (PubChem CID 106706680) has the molecular formula C9H7ClF3NO4 and a molecular weight of 285.61 g/mol. Its IUPAC name is 2-chloro-1-nitro-4-(2,2,2-trifluoroethoxymethoxy)benzene.
| Compound Name | 2-chloro-1-nitro-4-(2,2,2-trifluoroethoxymethoxy)benzene |
|---|---|
| PubChem CID | 106706680 |
| Molecular Formula | C9H7ClF3NO4 |
| Molecular Weight | 285.61 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 2-chloro-1-nitro-4-(2,2,2-trifluoroethoxymethoxy)benzene |
| SMILES | O=[N+]([O-])c1ccc(OCOCC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C9H7ClF3NO4/c10-7-3-6(1-2-8(7)14(15)16)18-5-17-4-9(11,12)13/h1-3H,4-5H2 |
| InChIKey | JMMGRKAWZSYKCO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.61 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|