C16H10F6N2O7 — CID 88829100
1-nitro-4-[4-nitro-3-(2,2,2-trifluoroethoxy)phenoxy]-2-(2,2,2-trifluoroethoxy)benzene (PubChem CID 88829100) has the molecular formula C16H10F6N2O7 and a molecular weight of 456.25 g/mol. Its IUPAC name is 1-nitro-4-[4-nitro-3-(2,2,2-trifluoroethoxy)phenoxy]-2-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 1-nitro-4-[4-nitro-3-(2,2,2-trifluoroethoxy)phenoxy]-2-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 88829100 |
| Molecular Formula | C16H10F6N2O7 |
| Molecular Weight | 456.25 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 1-nitro-4-[4-nitro-3-(2,2,2-trifluoroethoxy)phenoxy]-2-(2,2,2-trifluoroethoxy)benzene |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc([N+](=O)[O-])c(OCC(F)(F)F)c2)cc1OCC(F)(F)F |
| InChI | InChI=1S/C16H10F6N2O7/c17-15(18,19)7-29-13-5-9(1-3-11(13)23(25)26)31-10-2-4-12(24(27)28)14(6-10)30-8-16(20,21)22/h1-6H,7-8H2 |
| InChIKey | VQBBCVHCHCPBIE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 113.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.25 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|