C9H6F6N2O4 — CID 12868380
5-nitro-2,4-bis(2,2,2-trifluoroethoxy)pyridine (PubChem CID 12868380) has the molecular formula C9H6F6N2O4 and a molecular weight of 320.15 g/mol. Its IUPAC name is 5-nitro-2,4-bis(2,2,2-trifluoroethoxy)pyridine.
| Compound Name | 5-nitro-2,4-bis(2,2,2-trifluoroethoxy)pyridine |
|---|---|
| PubChem CID | 12868380 |
| Molecular Formula | C9H6F6N2O4 |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 5-nitro-2,4-bis(2,2,2-trifluoroethoxy)pyridine |
| SMILES | O=[N+]([O-])c1cnc(OCC(F)(F)F)cc1OCC(F)(F)F |
| InChI | InChI=1S/C9H6F6N2O4/c10-8(11,12)3-20-6-1-7(21-4-9(13,14)15)16-2-5(6)17(18)19/h1-2H,3-4H2 |
| InChIKey | ZKSBDAQNOKROBG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|