C14H9ClF3N3O4 — CID 46467097
4-chloro-2-nitro-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzamide (PubChem CID 46467097) has the molecular formula C14H9ClF3N3O4 and a molecular weight of 375.69 g/mol. Its IUPAC name is 4-chloro-2-nitro-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzamide.
| Compound Name | 4-chloro-2-nitro-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 46467097 |
| Molecular Formula | C14H9ClF3N3O4 |
| Molecular Weight | 375.69 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 4-chloro-2-nitro-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzamide |
| SMILES | O=C(Nc1ccc(OCC(F)(F)F)nc1)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H9ClF3N3O4/c15-8-1-3-10(11(5-8)21(23)24)13(22)20-9-2-4-12(19-6-9)25-7-14(16,17)18/h1-6H,7H2,(H,20,22) |
| InChIKey | CHJSHKZMJRJONA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.69 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|