C14H10F8N4O4Pd — CID 161278647
2-fluoro-5-nitro-4-(2,2,2-trifluoroethoxy)pyridine;6-fluoro-4-(2,2,2-trifluoroethoxy)pyridin-3-amine;palladium (PubChem CID 161278647) has the molecular formula C14H10F8N4O4Pd and a molecular weight of 556.66 g/mol. Its IUPAC name is 2-fluoro-5-nitro-4-(2,2,2-trifluoroethoxy)pyridine;6-fluoro-4-(2,2,2-trifluoroethoxy)pyridin-3-amine;palladium.
| Compound Name | 2-fluoro-5-nitro-4-(2,2,2-trifluoroethoxy)pyridine;6-fluoro-4-(2,2,2-trifluoroethoxy)pyridin-3-amine;palladium |
|---|---|
| PubChem CID | 161278647 |
| Molecular Formula | C14H10F8N4O4Pd |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 555.96 |
| IUPAC Name | 2-fluoro-5-nitro-4-(2,2,2-trifluoroethoxy)pyridine;6-fluoro-4-(2,2,2-trifluoroethoxy)pyridin-3-amine;palladium |
| SMILES | Nc1cnc(F)cc1OCC(F)(F)F.O=[N+]([O-])c1cnc(F)cc1OCC(F)(F)F.[Pd] |
| InChI | InChI=1S/C7H4F4N2O3.C7H6F4N2O.Pd/c8-6-1-5(16-3-7(9,10)11)4(2-12-6)13(14)15;8-6-1-5(4(12)2-13-6)14-3-7(9,10)11;/h1-2H,3H2;1-2H,3,12H2; |
| InChIKey | VETVWDXLXAUYNP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|