C9H9F3N2O5S — CID 43342373
2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide (PubChem CID 43342373) has the molecular formula C9H9F3N2O5S and a molecular weight of 314.24 g/mol. Its IUPAC name is 2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide.
| Compound Name | 2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 43342373 |
| Molecular Formula | C9H9F3N2O5S |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 2-methyl-5-nitro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide |
| SMILES | Cc1cc(OCC(F)(F)F)c([N+](=O)[O-])cc1S(N)(=O)=O |
| InChI | InChI=1S/C9H9F3N2O5S/c1-5-2-7(19-4-9(10,11)12)6(14(15)16)3-8(5)20(13,17)18/h2-3H,4H2,1H3,(H2,13,17,18) |
| InChIKey | NZCHQRSNDHNLCS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|