C9H10FN3O6S — CID 82913819
2-(5-fluoro-2-nitro-4-sulfamoylphenoxy)-N-methylacetamide (PubChem CID 82913819) has the molecular formula C9H10FN3O6S and a molecular weight of 307.26 g/mol. Its IUPAC name is 2-(5-fluoro-2-nitro-4-sulfamoylphenoxy)-N-methylacetamide.
| Compound Name | 2-(5-fluoro-2-nitro-4-sulfamoylphenoxy)-N-methylacetamide |
|---|---|
| PubChem CID | 82913819 |
| Molecular Formula | C9H10FN3O6S |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2-(5-fluoro-2-nitro-4-sulfamoylphenoxy)-N-methylacetamide |
| SMILES | CNC(=O)COc1cc(F)c(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10FN3O6S/c1-12-9(14)4-19-7-2-5(10)8(20(11,17)18)3-6(7)13(15)16/h2-3H,4H2,1H3,(H,12,14)(H2,11,17,18) |
| InChIKey | AWEOKBXNRSYBCQ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|