C12H16N2O6S — CID 63937667
2-methyl-5-nitro-4-(oxan-4-yloxy)benzenesulfonamide (PubChem CID 63937667) has the molecular formula C12H16N2O6S and a molecular weight of 316.33 g/mol. Its IUPAC name is 2-methyl-5-nitro-4-(oxan-4-yloxy)benzenesulfonamide.
| Compound Name | 2-methyl-5-nitro-4-(oxan-4-yloxy)benzenesulfonamide |
|---|---|
| PubChem CID | 63937667 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-methyl-5-nitro-4-(oxan-4-yloxy)benzenesulfonamide |
| SMILES | Cc1cc(OC2CCOCC2)c([N+](=O)[O-])cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H16N2O6S/c1-8-6-11(20-9-2-4-19-5-3-9)10(14(15)16)7-12(8)21(13,17)18/h6-7,9H,2-5H2,1H3,(H2,13,17,18) |
| InChIKey | RDHGPPZPKFHGSL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|