C10H9BrF4O2 — CID 65202998
1-bromo-2-fluoro-4-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene (PubChem CID 65202998) has the molecular formula C10H9BrF4O2 and a molecular weight of 317.08 g/mol. Its IUPAC name is 1-bromo-2-fluoro-4-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene.
| Compound Name | 1-bromo-2-fluoro-4-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 65202998 |
| Molecular Formula | C10H9BrF4O2 |
| Molecular Weight | 317.08 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 1-bromo-2-fluoro-4-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene |
| SMILES | Fc1cc(OCCOCC(F)(F)F)ccc1Br |
| InChI | InChI=1S/C10H9BrF4O2/c11-8-2-1-7(5-9(8)12)17-4-3-16-6-10(13,14)15/h1-2,5H,3-4,6H2 |
| InChIKey | HUGPCHBBQIHTRW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.08 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|