C14H13ClF4O2 — CID 65202491
1-(4-chlorobut-1-ynyl)-2-fluoro-4-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene (PubChem CID 65202491) has the molecular formula C14H13ClF4O2 and a molecular weight of 324.70 g/mol. Its IUPAC name is 1-(4-chlorobut-1-ynyl)-2-fluoro-4-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene.
| Compound Name | 1-(4-chlorobut-1-ynyl)-2-fluoro-4-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 65202491 |
| Molecular Formula | C14H13ClF4O2 |
| Molecular Weight | 324.70 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 1-(4-chlorobut-1-ynyl)-2-fluoro-4-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene |
| SMILES | Fc1cc(OCCOCC(F)(F)F)ccc1C#CCCCl |
| InChI | InChI=1S/C14H13ClF4O2/c15-6-2-1-3-11-4-5-12(9-13(11)16)21-8-7-20-10-14(17,18)19/h4-5,9H,2,6-8,10H2 |
| InChIKey | JNXKLIFJIKSIFX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.70 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|