C12H14F4O3 — CID 107719630
1-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethanol (PubChem CID 107719630) has the molecular formula C12H14F4O3 and a molecular weight of 282.23 g/mol. Its IUPAC name is 1-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethanol.
| Compound Name | 1-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 107719630 |
| Molecular Formula | C12H14F4O3 |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1-[2-fluoro-4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethanol |
| SMILES | CC(O)c1ccc(OCCOCC(F)(F)F)cc1F |
| InChI | InChI=1S/C12H14F4O3/c1-8(17)10-3-2-9(6-11(10)13)19-5-4-18-7-12(14,15)16/h2-3,6,8,17H,4-5,7H2,1H3 |
| InChIKey | SBYAEIWVYRCEAF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|