C20H17F3O5 — CID 175043297
(2-prop-2-enoyloxyphenyl) 4-(4,4,4-trifluorobutoxy)benzoate (PubChem CID 175043297) has the molecular formula C20H17F3O5 and a molecular weight of 394.35 g/mol. Its IUPAC name is (2-prop-2-enoyloxyphenyl) 4-(4,4,4-trifluorobutoxy)benzoate.
| Compound Name | (2-prop-2-enoyloxyphenyl) 4-(4,4,4-trifluorobutoxy)benzoate |
|---|---|
| PubChem CID | 175043297 |
| Molecular Formula | C20H17F3O5 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (2-prop-2-enoyloxyphenyl) 4-(4,4,4-trifluorobutoxy)benzoate |
| SMILES | C=CC(=O)Oc1ccccc1OC(=O)c1ccc(OCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17F3O5/c1-2-18(24)27-16-6-3-4-7-17(16)28-19(25)14-8-10-15(11-9-14)26-13-5-12-20(21,22)23/h2-4,6-11H,1,5,12-13H2 |
| InChIKey | BBRKDFVGXYDRQU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|