C31H32F4O6 — CID 123400778
[4-[[4-[difluoro-(4-prop-2-enoyloxyphenyl)methoxy]-3-methylphenoxy]-difluoromethyl]phenyl] prop-2-enoate;ethane (PubChem CID 123400778) has the molecular formula C31H32F4O6 and a molecular weight of 576.58 g/mol. Its IUPAC name is [4-[[4-[difluoro-(4-prop-2-enoyloxyphenyl)methoxy]-3-methylphenoxy]-difluoromethyl]phenyl] prop-2-enoate;ethane.
| Compound Name | [4-[[4-[difluoro-(4-prop-2-enoyloxyphenyl)methoxy]-3-methylphenoxy]-difluoromethyl]phenyl] prop-2-enoate;ethane |
|---|---|
| PubChem CID | 123400778 |
| Molecular Formula | C31H32F4O6 |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | [4-[[4-[difluoro-(4-prop-2-enoyloxyphenyl)methoxy]-3-methylphenoxy]-difluoromethyl]phenyl] prop-2-enoate;ethane |
| SMILES | C=CC(=O)Oc1ccc(C(F)(F)Oc2ccc(OC(F)(F)c3ccc(OC(=O)C=C)cc3)c(C)c2)cc1.CC.CC |
| InChI | InChI=1S/C27H20F4O6.2C2H6/c1-4-24(32)34-20-10-6-18(7-11-20)26(28,29)36-22-14-15-23(17(3)16-22)37-27(30,31)19-8-12-21(13-9-19)35-25(33)5-2;2*1-2/h4-16H,1-2H2,3H3;2*1-2H3 |
| InChIKey | JCALLQIDBMTIMW-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|