C22H20F2O5 — CID 126680865
[4-[difluoro-[4-(prop-2-enoyloxymethyl)phenoxy]methyl]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 126680865) has the molecular formula C22H20F2O5 and a molecular weight of 402.39 g/mol. Its IUPAC name is [4-[difluoro-[4-(prop-2-enoyloxymethyl)phenoxy]methyl]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [4-[difluoro-[4-(prop-2-enoyloxymethyl)phenoxy]methyl]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 126680865 |
| Molecular Formula | C22H20F2O5 |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [4-[difluoro-[4-(prop-2-enoyloxymethyl)phenoxy]methyl]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc(OC(F)(F)c2ccc(COC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C22H20F2O5/c1-4-20(25)27-13-17-7-11-19(12-8-17)29-22(23,24)18-9-5-16(6-10-18)14-28-21(26)15(2)3/h4-12H,1-2,13-14H2,3H3 |
| InChIKey | VYXGLPLUJHBVAJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|