C23H22F2O5 — CID 89424130
[4-[difluoro-[4-(2-methylprop-2-enoyloxymethyl)phenoxy]methyl]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 89424130) has the molecular formula C23H22F2O5 and a molecular weight of 416.42 g/mol. Its IUPAC name is [4-[difluoro-[4-(2-methylprop-2-enoyloxymethyl)phenoxy]methyl]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [4-[difluoro-[4-(2-methylprop-2-enoyloxymethyl)phenoxy]methyl]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89424130 |
| Molecular Formula | C23H22F2O5 |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [4-[difluoro-[4-(2-methylprop-2-enoyloxymethyl)phenoxy]methyl]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1ccc(OC(F)(F)c2ccc(COC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C23H22F2O5/c1-15(2)21(26)28-13-17-5-9-19(10-6-17)23(24,25)30-20-11-7-18(8-12-20)14-29-22(27)16(3)4/h5-12H,1,3,13-14H2,2,4H3 |
| InChIKey | MNKDPMXNCIIQGC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|