C20H30O2 — CID 143828541
[4-(2,5,5-trimethylhexan-3-yl)phenyl]methyl 2-methylprop-2-enoate (PubChem CID 143828541) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is [4-(2,5,5-trimethylhexan-3-yl)phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [4-(2,5,5-trimethylhexan-3-yl)phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 143828541 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | [4-(2,5,5-trimethylhexan-3-yl)phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1ccc(C(CC(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C20H30O2/c1-14(2)18(12-20(5,6)7)17-10-8-16(9-11-17)13-22-19(21)15(3)4/h8-11,14,18H,3,12-13H2,1-2,4-7H3 |
| InChIKey | NVCIFQDNLUDLBT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|