C21H19F2NO4 — CID 89401131
(E)-3-[4-[[4-(4-cyanobutoxy)phenoxy]-difluoromethyl]phenyl]prop-2-enoic acid (PubChem CID 89401131) has the molecular formula C21H19F2NO4 and a molecular weight of 387.38 g/mol. Its IUPAC name is (E)-3-[4-[[4-(4-cyanobutoxy)phenoxy]-difluoromethyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[4-(4-cyanobutoxy)phenoxy]-difluoromethyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89401131 |
| Molecular Formula | C21H19F2NO4 |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | (E)-3-[4-[[4-(4-cyanobutoxy)phenoxy]-difluoromethyl]phenyl]prop-2-enoic acid |
| SMILES | N#CCCCCOc1ccc(OC(F)(F)c2ccc(/C=C/C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C21H19F2NO4/c22-21(23,17-7-4-16(5-8-17)6-13-20(25)26)28-19-11-9-18(10-12-19)27-15-3-1-2-14-24/h4-13H,1-3,15H2,(H,25,26)/b13-6+ |
| InChIKey | WFMBSDGQSYWVKT-AWNIVKPZSA-N |
| XLogP | 4.99 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|