C33H35F2N3O6 — CID 123987630
3,5-diamino-4-[2-[3-[4-[[4-(5-cyanopentoxy)phenyl]-difluoromethoxy]phenyl]prop-2-enoyloxy]butyl]benzoic acid (PubChem CID 123987630) has the molecular formula C33H35F2N3O6 and a molecular weight of 607.65 g/mol. Its IUPAC name is 3,5-diamino-4-[2-[3-[4-[[4-(5-cyanopentoxy)phenyl]-difluoromethoxy]phenyl]prop-2-enoyloxy]butyl]benzoic acid.
| Compound Name | 3,5-diamino-4-[2-[3-[4-[[4-(5-cyanopentoxy)phenyl]-difluoromethoxy]phenyl]prop-2-enoyloxy]butyl]benzoic acid |
|---|---|
| PubChem CID | 123987630 |
| Molecular Formula | C33H35F2N3O6 |
| Molecular Weight | 607.65 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | 3,5-diamino-4-[2-[3-[4-[[4-(5-cyanopentoxy)phenyl]-difluoromethoxy]phenyl]prop-2-enoyloxy]butyl]benzoic acid |
| SMILES | CCC(Cc1c(N)cc(C(=O)O)cc1N)OC(=O)C=Cc1ccc(OC(F)(F)c2ccc(OCCCCCC#N)cc2)cc1 |
| InChI | InChI=1S/C33H35F2N3O6/c1-2-25(21-28-29(37)19-23(32(40)41)20-30(28)38)43-31(39)16-9-22-7-12-27(13-8-22)44-33(34,35)24-10-14-26(15-11-24)42-18-6-4-3-5-17-36/h7-16,19-20,25H,2-6,18,21,37-38H2,1H3,(H,40,41) |
| InChIKey | SXJDEMSAEOBMOJ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 157.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.65 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|