C13H12BrF3O3 — CID 115514453
(E)-3-[2-bromo-5-(4,4,4-trifluorobutoxy)phenyl]prop-2-enoic acid (PubChem CID 115514453) has the molecular formula C13H12BrF3O3 and a molecular weight of 353.13 g/mol. Its IUPAC name is (E)-3-[2-bromo-5-(4,4,4-trifluorobutoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-bromo-5-(4,4,4-trifluorobutoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115514453 |
| Molecular Formula | C13H12BrF3O3 |
| Molecular Weight | 353.13 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | (E)-3-[2-bromo-5-(4,4,4-trifluorobutoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(OCCCC(F)(F)F)ccc1Br |
| InChI | InChI=1S/C13H12BrF3O3/c14-11-4-3-10(8-9(11)2-5-12(18)19)20-7-1-6-13(15,16)17/h2-5,8H,1,6-7H2,(H,18,19)/b5-2+ |
| InChIKey | FUZHXTMXIKGUBO-GORDUTHDSA-N |
| XLogP | 4.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.13 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|