C27H37F3O — CID 153149489
1-[[4-[(E)-2-(4-cyclohexylcyclohexyl)ethenyl]cyclohexyl]-difluoromethoxy]-3-fluorobenzene (PubChem CID 153149489) has the molecular formula C27H37F3O and a molecular weight of 434.59 g/mol. Its IUPAC name is 1-[[4-[(E)-2-(4-cyclohexylcyclohexyl)ethenyl]cyclohexyl]-difluoromethoxy]-3-fluorobenzene.
| Compound Name | 1-[[4-[(E)-2-(4-cyclohexylcyclohexyl)ethenyl]cyclohexyl]-difluoromethoxy]-3-fluorobenzene |
|---|---|
| PubChem CID | 153149489 |
| Molecular Formula | C27H37F3O |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 1-[[4-[(E)-2-(4-cyclohexylcyclohexyl)ethenyl]cyclohexyl]-difluoromethoxy]-3-fluorobenzene |
| SMILES | Fc1cccc(OC(F)(F)C2CCC(/C=C/C3CCC(C4CCCCC4)CC3)CC2)c1 |
| InChI | InChI=1S/C27H37F3O/c28-25-7-4-8-26(19-25)31-27(29,30)24-17-13-21(14-18-24)10-9-20-11-15-23(16-12-20)22-5-2-1-3-6-22/h4,7-10,19-24H,1-3,5-6,11-18H2/b10-9+ |
| InChIKey | WAESVSAGBNOZHE-MDZDMXLPSA-N |
| XLogP | 8.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|