C33H39F7O2 — CID 122502306
4-[difluoro-[4-[(E)-2-(4-pentylcyclohexyl)ethenyl]cyclohexyl]methoxy]-1-[(3,4-difluorophenoxy)-difluoromethyl]-2-fluorobenzene (PubChem CID 122502306) has the molecular formula C33H39F7O2 and a molecular weight of 600.66 g/mol. Its IUPAC name is 4-[difluoro-[4-[(E)-2-(4-pentylcyclohexyl)ethenyl]cyclohexyl]methoxy]-1-[(3,4-difluorophenoxy)-difluoromethyl]-2-fluorobenzene.
| Compound Name | 4-[difluoro-[4-[(E)-2-(4-pentylcyclohexyl)ethenyl]cyclohexyl]methoxy]-1-[(3,4-difluorophenoxy)-difluoromethyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 122502306 |
| Molecular Formula | C33H39F7O2 |
| Molecular Weight | 600.66 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | 4-[difluoro-[4-[(E)-2-(4-pentylcyclohexyl)ethenyl]cyclohexyl]methoxy]-1-[(3,4-difluorophenoxy)-difluoromethyl]-2-fluorobenzene |
| SMILES | CCCCCC1CCC(/C=C/C2CCC(C(F)(F)Oc3ccc(C(F)(F)Oc4ccc(F)c(F)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C33H39F7O2/c1-2-3-4-5-22-6-8-23(9-7-22)10-11-24-12-14-25(15-13-24)32(37,38)41-26-16-18-28(30(35)20-26)33(39,40)42-27-17-19-29(34)31(36)21-27/h10-11,16-25H,2-9,12-15H2,1H3/b11-10+ |
| InChIKey | BBYFKLVEKJFDPP-ZHACJKMWSA-N |
| XLogP | 10.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.66 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|