C42H50F6N2O2S — CID 121289294
4,7-bis[4-[difluoro-(4-pentylcyclohexyl)methoxy]-2-fluorophenyl]-2,1,3-benzothiadiazole (PubChem CID 121289294) has the molecular formula C42H50F6N2O2S and a molecular weight of 760.93 g/mol. Its IUPAC name is 4,7-bis[4-[difluoro-(4-pentylcyclohexyl)methoxy]-2-fluorophenyl]-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis[4-[difluoro-(4-pentylcyclohexyl)methoxy]-2-fluorophenyl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 121289294 |
| Molecular Formula | C42H50F6N2O2S |
| Molecular Weight | 760.93 g/mol |
| Exact Mass | 760.35 |
| IUPAC Name | 4,7-bis[4-[difluoro-(4-pentylcyclohexyl)methoxy]-2-fluorophenyl]-2,1,3-benzothiadiazole |
| SMILES | CCCCCC1CCC(C(F)(F)Oc2ccc(-c3ccc(-c4ccc(OC(F)(F)C5CCC(CCCCC)CC5)cc4F)c4nsnc34)c(F)c2)CC1 |
| InChI | InChI=1S/C42H50F6N2O2S/c1-3-5-7-9-27-11-15-29(16-12-27)41(45,46)51-31-19-21-33(37(43)25-31)35-23-24-36(40-39(35)49-53-50-40)34-22-20-32(26-38(34)44)52-42(47,48)30-17-13-28(14-18-30)10-8-6-4-2/h19-30H,3-18H2,1-2H3 |
| InChIKey | ZARDJQBCVJFVHP-UHFFFAOYSA-N |
| XLogP | 14.02 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.93 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|