C25H27F5O — CID 134465107
7-[difluoro-(4-pentylcyclohexyl)methoxy]-1,2,8-trifluoro-3-methylbiphenylene (PubChem CID 134465107) has the molecular formula C25H27F5O and a molecular weight of 438.48 g/mol. Its IUPAC name is 7-[difluoro-(4-pentylcyclohexyl)methoxy]-1,2,8-trifluoro-3-methylbiphenylene.
| Compound Name | 7-[difluoro-(4-pentylcyclohexyl)methoxy]-1,2,8-trifluoro-3-methylbiphenylene |
|---|---|
| PubChem CID | 134465107 |
| Molecular Formula | C25H27F5O |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 7-[difluoro-(4-pentylcyclohexyl)methoxy]-1,2,8-trifluoro-3-methylbiphenylene |
| SMILES | CCCCCC1CCC(C(F)(F)Oc2ccc3c(c2F)-c2c-3cc(C)c(F)c2F)CC1 |
| InChI | InChI=1S/C25H27F5O/c1-3-4-5-6-15-7-9-16(10-8-15)25(29,30)31-19-12-11-17-18-13-14(2)22(26)24(28)21(18)20(17)23(19)27/h11-13,15-16H,3-10H2,1-2H3 |
| InChIKey | RBQWZYYUVNTFOK-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|