C36H38F8O — CID 118601397
1-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]cyclohexyl]-2,3-difluoro-4-(4-pentylcyclohexyl)benzene (PubChem CID 118601397) has the molecular formula C36H38F8O and a molecular weight of 638.68 g/mol. Its IUPAC name is 1-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]cyclohexyl]-2,3-difluoro-4-(4-pentylcyclohexyl)benzene.
| Compound Name | 1-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]cyclohexyl]-2,3-difluoro-4-(4-pentylcyclohexyl)benzene |
|---|---|
| PubChem CID | 118601397 |
| Molecular Formula | C36H38F8O |
| Molecular Weight | 638.68 g/mol |
| Exact Mass | 638.28 |
| IUPAC Name | 1-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]cyclohexyl]-2,3-difluoro-4-(4-pentylcyclohexyl)benzene |
| SMILES | CCCCCC1CCC(c2ccc(C3CCC(C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)CC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C36H38F8O/c1-2-3-4-5-21-6-8-22(9-7-21)28-16-17-29(34(41)33(28)40)23-10-12-25(13-11-23)36(43,44)45-26-14-15-27(30(37)20-26)24-18-31(38)35(42)32(39)19-24/h14-23,25H,2-13H2,1H3 |
| InChIKey | LKLJOKKNDLADIW-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.68 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|