C37H46F8O2 — CID 89280243
5-[[4-[4-[difluoro-[4-(4-pentylcyclohexyl)cyclohexyl]methoxy]-2-fluorophenyl]cyclohexyl]-difluoromethoxy]-1,2,3-trifluorobenzene (PubChem CID 89280243) has the molecular formula C37H46F8O2 and a molecular weight of 674.76 g/mol. Its IUPAC name is 5-[[4-[4-[difluoro-[4-(4-pentylcyclohexyl)cyclohexyl]methoxy]-2-fluorophenyl]cyclohexyl]-difluoromethoxy]-1,2,3-trifluorobenzene.
| Compound Name | 5-[[4-[4-[difluoro-[4-(4-pentylcyclohexyl)cyclohexyl]methoxy]-2-fluorophenyl]cyclohexyl]-difluoromethoxy]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 89280243 |
| Molecular Formula | C37H46F8O2 |
| Molecular Weight | 674.76 g/mol |
| Exact Mass | 674.34 |
| IUPAC Name | 5-[[4-[4-[difluoro-[4-(4-pentylcyclohexyl)cyclohexyl]methoxy]-2-fluorophenyl]cyclohexyl]-difluoromethoxy]-1,2,3-trifluorobenzene |
| SMILES | CCCCCC1CCC(C2CCC(C(F)(F)Oc3ccc(C4CCC(C(F)(F)Oc5cc(F)c(F)c(F)c5)CC4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C37H46F8O2/c1-2-3-4-5-23-6-8-24(9-7-23)25-10-14-27(15-11-25)36(42,43)46-29-18-19-31(32(38)20-29)26-12-16-28(17-13-26)37(44,45)47-30-21-33(39)35(41)34(40)22-30/h18-28H,2-17H2,1H3 |
| InChIKey | QDPIWKPPENPMSF-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.76 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|