C23H33F5O2 — CID 161263731
2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]-5-pentyloxane;molecular hydrogen (PubChem CID 161263731) has the molecular formula C23H33F5O2 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]-5-pentyloxane;molecular hydrogen.
| Compound Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]-5-pentyloxane;molecular hydrogen |
|---|---|
| PubChem CID | 161263731 |
| Molecular Formula | C23H33F5O2 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]-5-pentyloxane;molecular hydrogen |
| SMILES | CCCCCC1CCC(C2CCC(C(F)(F)Oc3cc(F)c(F)c(F)c3)CC2)OC1.[H][H] |
| InChI | InChI=1S/C23H31F5O2.H2/c1-2-3-4-5-15-6-11-21(29-14-15)16-7-9-17(10-8-16)23(27,28)30-18-12-19(24)22(26)20(25)13-18;/h12-13,15-17,21H,2-11,14H2,1H3;1H |
| InChIKey | VCXAAWDFVYEJRZ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|