C18H24F4O2 — CID 141298262
4-[difluoro-(4-pentylcyclohexyl)methoxy]-2,3-difluorophenol (PubChem CID 141298262) has the molecular formula C18H24F4O2 and a molecular weight of 348.38 g/mol. Its IUPAC name is 4-[difluoro-(4-pentylcyclohexyl)methoxy]-2,3-difluorophenol.
| Compound Name | 4-[difluoro-(4-pentylcyclohexyl)methoxy]-2,3-difluorophenol |
|---|---|
| PubChem CID | 141298262 |
| Molecular Formula | C18H24F4O2 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 4-[difluoro-(4-pentylcyclohexyl)methoxy]-2,3-difluorophenol |
| SMILES | CCCCCC1CCC(C(F)(F)Oc2ccc(O)c(F)c2F)CC1 |
| InChI | InChI=1S/C18H24F4O2/c1-2-3-4-5-12-6-8-13(9-7-12)18(21,22)24-15-11-10-14(23)16(19)17(15)20/h10-13,23H,2-9H2,1H3 |
| InChIKey | XPHFUEBVWWVFNS-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|