C35H50F8O — CID 20750894
1-[difluoro-[4-(4-propylcyclohexyl)cyclohexyl]methoxy]-4-(4-pentylcyclohexyl)-2,3-bis(trifluoromethyl)benzene (PubChem CID 20750894) has the molecular formula C35H50F8O and a molecular weight of 638.77 g/mol. Its IUPAC name is 1-[difluoro-[4-(4-propylcyclohexyl)cyclohexyl]methoxy]-4-(4-pentylcyclohexyl)-2,3-bis(trifluoromethyl)benzene.
| Compound Name | 1-[difluoro-[4-(4-propylcyclohexyl)cyclohexyl]methoxy]-4-(4-pentylcyclohexyl)-2,3-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 20750894 |
| Molecular Formula | C35H50F8O |
| Molecular Weight | 638.77 g/mol |
| Exact Mass | 638.37 |
| IUPAC Name | 1-[difluoro-[4-(4-propylcyclohexyl)cyclohexyl]methoxy]-4-(4-pentylcyclohexyl)-2,3-bis(trifluoromethyl)benzene |
| SMILES | CCCCCC1CCC(c2ccc(OC(F)(F)C3CCC(C4CCC(CCC)CC4)CC3)c(C(F)(F)F)c2C(F)(F)F)CC1 |
| InChI | InChI=1S/C35H50F8O/c1-3-5-6-8-24-11-15-27(16-12-24)29-21-22-30(32(34(39,40)41)31(29)33(36,37)38)44-35(42,43)28-19-17-26(18-20-28)25-13-9-23(7-4-2)10-14-25/h21-28H,3-20H2,1-2H3 |
| InChIKey | SNKVNBMHBHEQGT-UHFFFAOYSA-N |
| XLogP | 12.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.77 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|